About 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane
4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane (PubChem CID 143167322) has the molecular formula C20H40O2S2
and a molecular weight of 376.67 g/mol. Its IUPAC name is 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane.
Molecular Properties
| Compound Name | 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane |
| PubChem CID | 143167322 |
| Molecular Formula | C20H40O2S2 |
| Molecular Weight | 376.67 g/mol |
| Exact Mass | 376.25 |
| IUPAC Name | 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane |
| SMILES | CC1CCOCC1.CCC1CCS(=O)CC1.CCC1CCSCC1 |
| InChI | InChI=1S/C7H14OS.C7H14S.C6H12O/c1-2-7-3-5-9(8)6-4-7;1-2-7-3-5-8-6-4-7;1-6-2-4-7-5-3-6/h7H,2-6H2,1H3;7H,2-6H2,1H3;6H,2-5H2,1H3 |
| InChIKey | JRNOCXGXXOGCCI-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.67 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane?
The IUPAC name of 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane (CID 143167322) is 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane.
What is the SMILES notation for 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane?
The canonical SMILES for 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane is CC1CCOCC1.CCC1CCS(=O)CC1.CCC1CCSCC1.
What is the InChIKey of 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane?
The InChIKey is JRNOCXGXXOGCCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14OS.C7H14S.C6H12O/c1-2-7-3-5-9(8)6-4-7;1-2-7-3-5-8-6-4-7;1-6-2-4-7-5-3-6/h7H,2-6H2,1H3;7H,2-6H2,1H3;6H,2-5H2,1H3.
What are the key properties of 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane?
4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane has a molecular weight of 376.67 g/mol, XLogP of 5.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylthiane;4-ethylthiane 1-oxide;4-methyloxane is sourced from PubChem (CID 143167322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).