About 3-phenylmethoxypropane-1,2-diamine
3-phenylmethoxypropane-1,2-diamine (PubChem CID 14316768) has the molecular formula C10H16N2O
and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-phenylmethoxypropane-1,2-diamine.
Molecular Properties
| Compound Name | 3-phenylmethoxypropane-1,2-diamine |
| PubChem CID | 14316768 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-phenylmethoxypropane-1,2-diamine |
| SMILES | NCC(N)COCc1ccccc1 |
| InChI | InChI=1S/C10H16N2O/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h1-5,10H,6-8,11-12H2 |
| InChIKey | DXIGRVGFGIFMHV-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-phenylmethoxypropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylmethoxypropane-1,2-diamine?
The IUPAC name of 3-phenylmethoxypropane-1,2-diamine (CID 14316768) is 3-phenylmethoxypropane-1,2-diamine.
What is the SMILES notation for 3-phenylmethoxypropane-1,2-diamine?
The canonical SMILES for 3-phenylmethoxypropane-1,2-diamine is NCC(N)COCc1ccccc1.
What is the InChIKey of 3-phenylmethoxypropane-1,2-diamine?
The InChIKey is DXIGRVGFGIFMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2O/c11-6-10(12)8-13-7-9-4-2-1-3-5-9/h1-5,10H,6-8,11-12H2.
What are the key properties of 3-phenylmethoxypropane-1,2-diamine?
3-phenylmethoxypropane-1,2-diamine has a molecular weight of 180.25 g/mol, XLogP of 0.49, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylmethoxypropane-1,2-diamine is sourced from PubChem (CID 14316768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).