About 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine
2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine (PubChem CID 14316854) has the molecular formula C19H16N2OS
and a molecular weight of 320.42 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine.
Molecular Properties
| Compound Name | 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine |
| PubChem CID | 14316854 |
| Molecular Formula | C19H16N2OS |
| Molecular Weight | 320.42 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine |
| SMILES | COc1ccc(-c2cc(C)c3c(n2)Nc2ccccc2S3)cc1 |
| InChI | InChI=1S/C19H16N2OS/c1-12-11-16(13-7-9-14(22-2)10-8-13)21-19-18(12)23-17-6-4-3-5-15(17)20-19/h3-11H,1-2H3,(H,20,21) |
| InChIKey | RWVKBEZFIRLMLM-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.42 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine?
The IUPAC name of 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine (CID 14316854) is 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine.
What is the SMILES notation for 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine?
The canonical SMILES for 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine is COc1ccc(-c2cc(C)c3c(n2)Nc2ccccc2S3)cc1.
What is the InChIKey of 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine?
The InChIKey is RWVKBEZFIRLMLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2OS/c1-12-11-16(13-7-9-14(22-2)10-8-13)21-19-18(12)23-17-6-4-3-5-15(17)20-19/h3-11H,1-2H3,(H,20,21).
What are the key properties of 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine?
2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine has a molecular weight of 320.42 g/mol, XLogP of 5.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxyphenyl)-4-methyl-10H-pyrido[3,2-b][1,4]benzothiazine is sourced from PubChem (CID 14316854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).