C16H6F2N2O6 — CID 14316870
10,11-difluoro-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid (PubChem CID 14316870) has the molecular formula C16H6F2N2O6 and a molecular weight of 360.23 g/mol. Its IUPAC name is 10,11-difluoro-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid.
| Compound Name | 10,11-difluoro-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid |
|---|---|
| PubChem CID | 14316870 |
| Molecular Formula | C16H6F2N2O6 |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 10,11-difluoro-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid |
| SMILES | O=C(O)c1cn2c3c(c(F)c(F)cc3c1=O)Oc1cc([N+](=O)[O-])ccc1-2 |
| InChI | InChI=1S/C16H6F2N2O6/c17-9-4-7-13-15(12(9)18)26-11-3-6(20(24)25)1-2-10(11)19(13)5-8(14(7)21)16(22)23/h1-5H,(H,22,23) |
| InChIKey | VAUQBYDQMDKROC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|