C21H17FN4O6 — CID 14316872
11-fluoro-10-(4-methylpiperazin-1-yl)-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid (PubChem CID 14316872) has the molecular formula C21H17FN4O6 and a molecular weight of 440.39 g/mol. Its IUPAC name is 11-fluoro-10-(4-methylpiperazin-1-yl)-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid.
| Compound Name | 11-fluoro-10-(4-methylpiperazin-1-yl)-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid |
|---|---|
| PubChem CID | 14316872 |
| Molecular Formula | C21H17FN4O6 |
| Molecular Weight | 440.39 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 11-fluoro-10-(4-methylpiperazin-1-yl)-5-nitro-14-oxo-8-oxa-1-azatetracyclo[7.7.1.02,7.013,17]heptadeca-2(7),3,5,9(17),10,12,15-heptaene-15-carboxylic acid |
| SMILES | CN1CCN(c2c(F)cc3c(=O)c(C(=O)O)cn4c3c2Oc2cc([N+](=O)[O-])ccc2-4)CC1 |
| InChI | InChI=1S/C21H17FN4O6/c1-23-4-6-24(7-5-23)18-14(22)9-12-17-20(18)32-16-8-11(26(30)31)2-3-15(16)25(17)10-13(19(12)27)21(28)29/h2-3,8-10H,4-7H2,1H3,(H,28,29) |
| InChIKey | HAXPEXLVBPFGTD-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 118.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.39 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|