C27H35F3N4O3 — CID 143169291
[(6R)-6-[4-[2-(2-hydroxyethylamino)ethoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone (PubChem CID 143169291) has the molecular formula C27H35F3N4O3 and a molecular weight of 520.60 g/mol. Its IUPAC name is [(6R)-6-[4-[2-(2-hydroxyethylamino)ethoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone.
| Compound Name | [(6R)-6-[4-[2-(2-hydroxyethylamino)ethoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 143169291 |
| Molecular Formula | C27H35F3N4O3 |
| Molecular Weight | 520.60 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | [(6R)-6-[4-[2-(2-hydroxyethylamino)ethoxy]-2,3-dimethylphenyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl]-[6-(trifluoromethyl)-3-pyridinyl]methanone |
| SMILES | Cc1c(OCCNCCO)ccc([C@H]2CCCC3CN(C(=O)c4ccc(C(F)(F)F)nc4)CCN32)c1C |
| InChI | InChI=1S/C27H35F3N4O3/c1-18-19(2)24(37-15-11-31-10-14-35)8-7-22(18)23-5-3-4-21-17-33(12-13-34(21)23)26(36)20-6-9-25(32-16-20)27(28,29)30/h6-9,16,21,23,31,35H,3-5,10-15,17H2,1-2H3/t21?,23-/m1/s1 |
| InChIKey | VCGOJUDXHSHMSE-JFGZAKSSSA-N |
| XLogP | 3.73 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.60 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|