About 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine
1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine (PubChem CID 143169639) has the molecular formula C24H53N3
and a molecular weight of 383.71 g/mol. Its IUPAC name is 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine.
Molecular Properties
| Compound Name | 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine |
| PubChem CID | 143169639 |
| Molecular Formula | C24H53N3 |
| Molecular Weight | 383.71 g/mol |
| Exact Mass | 383.42 |
| IUPAC Name | 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine |
| SMILES | CC.CC(C)C1CCCN1C.CC1CCCCN1C.CC1CCCN(C)C1 |
| InChI | InChI=1S/C8H17N.2C7H15N.C2H6/c1-7(2)8-5-4-6-9(8)3;1-7-4-3-5-8(2)6-7;1-7-5-3-4-6-8(7)2;1-2/h7-8H,4-6H2,1-3H3;2*7H,3-6H2,1-2H3;1-2H3 |
| InChIKey | XPODCEKPUWAFCJ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.71 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine?
The IUPAC name of 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine (CID 143169639) is 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine.
What is the SMILES notation for 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine?
The canonical SMILES for 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine is CC.CC(C)C1CCCN1C.CC1CCCCN1C.CC1CCCN(C)C1.
What is the InChIKey of 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine?
The InChIKey is XPODCEKPUWAFCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N.2C7H15N.C2H6/c1-7(2)8-5-4-6-9(8)3;1-7-4-3-5-8(2)6-7;1-7-5-3-4-6-8(7)2;1-2/h7-8H,4-6H2,1-3H3;2*7H,3-6H2,1-2H3;1-2H3.
What are the key properties of 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine?
1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine has a molecular weight of 383.71 g/mol, XLogP of 5.60, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylpiperidine;1,3-dimethylpiperidine;ethane;1-methyl-2-propan-2-ylpyrrolidine is sourced from PubChem (CID 143169639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).