About acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane
acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane (PubChem CID 143170013) has the molecular formula C13H24
and a molecular weight of 180.34 g/mol. Its IUPAC name is acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane.
Molecular Properties
| Compound Name | acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane |
| PubChem CID | 143170013 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane |
| SMILES | C#C.CC.CC1C[C@@H]2C[C@H](C1)C2C |
| InChI | InChI=1S/C9H16.C2H6.C2H2/c1-6-3-8-5-9(4-6)7(8)2;2*1-2/h6-9H,3-5H2,1-2H3;1-2H3;1-2H/t6?,7?,8-,9+;; |
| InChIKey | PJNWFRNGMPBVEB-AEEIEBTBSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane?
The IUPAC name of acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane (CID 143170013) is acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane.
What is the SMILES notation for acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane?
The canonical SMILES for acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane is C#C.CC.CC1C[C@@H]2C[C@H](C1)C2C.
What is the InChIKey of acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane?
The InChIKey is PJNWFRNGMPBVEB-AEEIEBTBSA-N. The full InChI is InChI=1S/C9H16.C2H6.C2H2/c1-6-3-8-5-9(4-6)7(8)2;2*1-2/h6-9H,3-5H2,1-2H3;1-2H3;1-2H/t6?,7?,8-,9+;;.
What are the key properties of acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane?
acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane has a molecular weight of 180.34 g/mol, XLogP of 3.96, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;(1S,5R)-3,6-dimethylbicyclo[3.1.1]heptane;ethane is sourced from PubChem (CID 143170013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).