C25H37IN2O4 — CID 143170023
(3S,4R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[1-(3-iodophenyl)ethyl]-N-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide (PubChem CID 143170023) has the molecular formula C25H37IN2O4 and a molecular weight of 556.49 g/mol. Its IUPAC name is (3S,4R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[1-(3-iodophenyl)ethyl]-N-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide.
| Compound Name | (3S,4R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[1-(3-iodophenyl)ethyl]-N-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 143170023 |
| Molecular Formula | C25H37IN2O4 |
| Molecular Weight | 556.49 g/mol |
| Exact Mass | 556.18 |
| IUPAC Name | (3S,4R)-4-[(1S)-1-hydroxyethyl]-5-(hydroxymethyl)-2-[1-(3-iodophenyl)ethyl]-N-[(1S,3S,5R)-2,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]-1,2-oxazolidine-3-carboxamide |
| SMILES | CC1[C@@H](NC(=O)[C@@H]2[C@H]([C@H](C)O)C(CO)ON2C(C)c2cccc(I)c2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C25H37IN2O4/c1-13-19-10-17(25(19,4)5)11-20(13)27-24(31)23-22(15(3)30)21(12-29)32-28(23)14(2)16-7-6-8-18(26)9-16/h6-9,13-15,17,19-23,29-30H,10-12H2,1-5H3,(H,27,31)/t13?,14?,15-,17+,19-,20-,21?,22+,23-/m0/s1 |
| InChIKey | YNAWLCMZMWGPSQ-LKFPQYLJSA-N |
| XLogP | 3.51 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|