C18H27NO4 — CID 143170129
(3aR,4S,6aS)-3-(hydroxymethyl)-4-methyl-1-[1-(3-methylphenyl)ethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one;ethane (PubChem CID 143170129) has the molecular formula C18H27NO4 and a molecular weight of 321.42 g/mol. Its IUPAC name is (3aR,4S,6aS)-3-(hydroxymethyl)-4-methyl-1-[1-(3-methylphenyl)ethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one;ethane.
| Compound Name | (3aR,4S,6aS)-3-(hydroxymethyl)-4-methyl-1-[1-(3-methylphenyl)ethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one;ethane |
|---|---|
| PubChem CID | 143170129 |
| Molecular Formula | C18H27NO4 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | (3aR,4S,6aS)-3-(hydroxymethyl)-4-methyl-1-[1-(3-methylphenyl)ethyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one;ethane |
| SMILES | CC.Cc1cccc(C(C)N2OC(CO)[C@H]3[C@H](C)OC(=O)[C@H]32)c1 |
| InChI | InChI=1S/C16H21NO4.C2H6/c1-9-5-4-6-12(7-9)10(2)17-15-14(13(8-18)21-17)11(3)20-16(15)19;1-2/h4-7,10-11,13-15,18H,8H2,1-3H3;1-2H3/t10?,11-,13?,14+,15-;/m0./s1 |
| InChIKey | WNLKIZYEOMMNSW-SJDHOIBASA-N |
| XLogP | 2.62 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |