About 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane
1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane (PubChem CID 143170234) has the molecular formula C22H34Cl2N2
and a molecular weight of 397.43 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane.
Molecular Properties
| Compound Name | 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane |
| PubChem CID | 143170234 |
| Molecular Formula | C22H34Cl2N2 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane |
| SMILES | CC.CC.CCc1cccc(CN(Cc2c(Cl)cccc2Cl)N(C)C)c1 |
| InChI | InChI=1S/C18H22Cl2N2.2C2H6/c1-4-14-7-5-8-15(11-14)12-22(21(2)3)13-16-17(19)9-6-10-18(16)20;2*1-2/h5-11H,4,12-13H2,1-3H3;2*1-2H3 |
| InChIKey | HVUSKONONHOBFS-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane?
The IUPAC name of 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane (CID 143170234) is 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane.
What is the SMILES notation for 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane?
The canonical SMILES for 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane is CC.CC.CCc1cccc(CN(Cc2c(Cl)cccc2Cl)N(C)C)c1.
What is the InChIKey of 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane?
The InChIKey is HVUSKONONHOBFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22Cl2N2.2C2H6/c1-4-14-7-5-8-15(11-14)12-22(21(2)3)13-16-17(19)9-6-10-18(16)20;2*1-2/h5-11H,4,12-13H2,1-3H3;2*1-2H3.
What are the key properties of 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane?
1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane has a molecular weight of 397.43 g/mol, XLogP of 7.09, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-dichlorophenyl)methyl]-1-[(3-ethylphenyl)methyl]-2,2-dimethylhydrazine;ethane is sourced from PubChem (CID 143170234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).