C11H19NO — CID 143170351
N-[(1S,3S,5R)-1,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]formamide (PubChem CID 143170351) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is N-[(1S,3S,5R)-1,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]formamide.
| Compound Name | N-[(1S,3S,5R)-1,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]formamide |
|---|---|
| PubChem CID | 143170351 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | N-[(1S,3S,5R)-1,6,6-trimethyl-3-bicyclo[3.1.1]heptanyl]formamide |
| SMILES | CC1(C)[C@H]2C[C@H](NC=O)C[C@]1(C)C2 |
| InChI | InChI=1S/C11H19NO/c1-10(2)8-4-9(12-7-13)6-11(10,3)5-8/h7-9H,4-6H2,1-3H3,(H,12,13)/t8-,9-,11-/m0/s1 |
| InChIKey | IBXDFJSABZHACG-QXEWZRGKSA-N |
| XLogP | 1.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|