About 2-bromo-4-methylbenzoic acid;ethane
2-bromo-4-methylbenzoic acid;ethane (PubChem CID 143170535) has the molecular formula C10H13BrO2
and a molecular weight of 245.12 g/mol. Its IUPAC name is 2-bromo-4-methylbenzoic acid;ethane.
Molecular Properties
| Compound Name | 2-bromo-4-methylbenzoic acid;ethane |
| PubChem CID | 143170535 |
| Molecular Formula | C10H13BrO2 |
| Molecular Weight | 245.12 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 2-bromo-4-methylbenzoic acid;ethane |
| SMILES | CC.Cc1ccc(C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C8H7BrO2.C2H6/c1-5-2-3-6(8(10)11)7(9)4-5;1-2/h2-4H,1H3,(H,10,11);1-2H3 |
| InChIKey | MOMSHAZECCUBPT-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.12 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-bromo-4-methylbenzoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-methylbenzoic acid;ethane?
The IUPAC name of 2-bromo-4-methylbenzoic acid;ethane (CID 143170535) is 2-bromo-4-methylbenzoic acid;ethane.
What is the SMILES notation for 2-bromo-4-methylbenzoic acid;ethane?
The canonical SMILES for 2-bromo-4-methylbenzoic acid;ethane is CC.Cc1ccc(C(=O)O)c(Br)c1.
What is the InChIKey of 2-bromo-4-methylbenzoic acid;ethane?
The InChIKey is MOMSHAZECCUBPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrO2.C2H6/c1-5-2-3-6(8(10)11)7(9)4-5;1-2/h2-4H,1H3,(H,10,11);1-2H3.
What are the key properties of 2-bromo-4-methylbenzoic acid;ethane?
2-bromo-4-methylbenzoic acid;ethane has a molecular weight of 245.12 g/mol, XLogP of 3.48, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-methylbenzoic acid;ethane is sourced from PubChem (CID 143170535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).