About 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid
1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (PubChem CID 143170635) has the molecular formula C8H15F2O5P
and a molecular weight of 260.17 g/mol. Its IUPAC name is 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
Molecular Properties
| Compound Name | 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| PubChem CID | 143170635 |
| Molecular Formula | C8H15F2O5P |
| Molecular Weight | 260.17 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid |
| SMILES | CC(C)(C)C(=O)OCOP(=O)(O)C(C)(F)F |
| InChI | InChI=1S/C8H15F2O5P/c1-7(2,3)6(11)14-5-15-16(12,13)8(4,9)10/h5H2,1-4H3,(H,12,13) |
| InChIKey | VPTGMNFXLBENRV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.17 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid?
The IUPAC name of 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid (CID 143170635) is 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid.
What is the SMILES notation for 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid?
The canonical SMILES for 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid is CC(C)(C)C(=O)OCOP(=O)(O)C(C)(F)F.
What is the InChIKey of 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid?
The InChIKey is VPTGMNFXLBENRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15F2O5P/c1-7(2,3)6(11)14-5-15-16(12,13)8(4,9)10/h5H2,1-4H3,(H,12,13).
What are the key properties of 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid?
1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid has a molecular weight of 260.17 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-difluoroethyl(2,2-dimethylpropanoyloxymethoxy)phosphinic acid is sourced from PubChem (CID 143170635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).