C23H25NO3 — CID 143170842
(3aR,6aS)-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one;ethane (PubChem CID 143170842) has the molecular formula C23H25NO3 and a molecular weight of 363.46 g/mol. Its IUPAC name is (3aR,6aS)-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one;ethane.
| Compound Name | (3aR,6aS)-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one;ethane |
|---|---|
| PubChem CID | 143170842 |
| Molecular Formula | C23H25NO3 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | (3aR,6aS)-1-[[4-[2-(4-methylphenyl)ethynyl]phenyl]methyl]-3,3a,4,6a-tetrahydrofuro[3,4-c][1,2]oxazol-6-one;ethane |
| SMILES | CC.Cc1ccc(C#Cc2ccc(CN3OC[C@H]4COC(=O)[C@H]43)cc2)cc1 |
| InChI | InChI=1S/C21H19NO3.C2H6/c1-15-2-4-16(5-3-15)6-7-17-8-10-18(11-9-17)12-22-20-19(14-25-22)13-24-21(20)23;1-2/h2-5,8-11,19-20H,12-14H2,1H3;1-2H3/t19-,20+;/m1./s1 |
| InChIKey | INCBTPCIUOFWGP-FDOHDBATSA-N |
| XLogP | 3.71 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|