C22H33N3O4S — CID 143170891
2-[2-ethenyl-4-(4-methylpiperidin-1-yl)sulfonylanilino]-N-(oxolan-2-ylmethyl)propanamide (PubChem CID 143170891) has the molecular formula C22H33N3O4S and a molecular weight of 435.59 g/mol. Its IUPAC name is 2-[2-ethenyl-4-(4-methylpiperidin-1-yl)sulfonylanilino]-N-(oxolan-2-ylmethyl)propanamide.
| Compound Name | 2-[2-ethenyl-4-(4-methylpiperidin-1-yl)sulfonylanilino]-N-(oxolan-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 143170891 |
| Molecular Formula | C22H33N3O4S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 2-[2-ethenyl-4-(4-methylpiperidin-1-yl)sulfonylanilino]-N-(oxolan-2-ylmethyl)propanamide |
| SMILES | C=Cc1cc(S(=O)(=O)N2CCC(C)CC2)ccc1NC(C)C(=O)NCC1CCCO1 |
| InChI | InChI=1S/C22H33N3O4S/c1-4-18-14-20(30(27,28)25-11-9-16(2)10-12-25)7-8-21(18)24-17(3)22(26)23-15-19-6-5-13-29-19/h4,7-8,14,16-17,19,24H,1,5-6,9-13,15H2,2-3H3,(H,23,26) |
| InChIKey | GRKLOEKHYLDWKS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |