C11H18N2O2 — CID 143170906
1-[[(5E)-5-[(Z)-but-2-enylidene]-6-methylidene-1,4-dioxan-2-yl]methyl]-2-methylhydrazine (PubChem CID 143170906) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1-[[(5E)-5-[(Z)-but-2-enylidene]-6-methylidene-1,4-dioxan-2-yl]methyl]-2-methylhydrazine.
| Compound Name | 1-[[(5E)-5-[(Z)-but-2-enylidene]-6-methylidene-1,4-dioxan-2-yl]methyl]-2-methylhydrazine |
|---|---|
| PubChem CID | 143170906 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1-[[(5E)-5-[(Z)-but-2-enylidene]-6-methylidene-1,4-dioxan-2-yl]methyl]-2-methylhydrazine |
| SMILES | C=C1OC(CNNC)CO/C1=C/C=C\C |
| InChI | InChI=1S/C11H18N2O2/c1-4-5-6-11-9(2)15-10(8-14-11)7-13-12-3/h4-6,10,12-13H,2,7-8H2,1,3H3/b5-4-,11-6+ |
| InChIKey | LZUGHQIYRIICLY-UMEJXRAUSA-N |
| XLogP | 1.10 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|