About (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate
(1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate (PubChem CID 143171105) has the molecular formula C12H11NO5
and a molecular weight of 249.22 g/mol. Its IUPAC name is (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate.
Molecular Properties
| Compound Name | (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate |
| PubChem CID | 143171105 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate |
| SMILES | COC(=O)OCN1CC(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H11NO5/c1-17-12(16)18-7-13-6-10(14)8-4-2-3-5-9(8)11(13)15/h2-5H,6-7H2,1H3 |
| InChIKey | KIHBHIFQSXURKX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate?
The IUPAC name of (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate (CID 143171105) is (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate.
What is the SMILES notation for (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate?
The canonical SMILES for (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate is COC(=O)OCN1CC(=O)c2ccccc2C1=O.
What is the InChIKey of (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate?
The InChIKey is KIHBHIFQSXURKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO5/c1-17-12(16)18-7-13-6-10(14)8-4-2-3-5-9(8)11(13)15/h2-5H,6-7H2,1H3.
What are the key properties of (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate?
(1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate has a molecular weight of 249.22 g/mol, XLogP of 1.07, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,4-dioxo-3H-isoquinolin-2-yl)methyl methyl carbonate is sourced from PubChem (CID 143171105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).