C30H35F2N3O5 — CID 143171428
3-[[3-[[1-(3-tert-butylphenyl)-4-hydroxyiminocyclohexyl]amino]-1-(3,5-difluorophenyl)-2-hydroxypropyl]amino]-4-methoxycyclobut-3-ene-1,2-dione (PubChem CID 143171428) has the molecular formula C30H35F2N3O5 and a molecular weight of 555.62 g/mol. Its IUPAC name is 3-[[3-[[1-(3-tert-butylphenyl)-4-hydroxyiminocyclohexyl]amino]-1-(3,5-difluorophenyl)-2-hydroxypropyl]amino]-4-methoxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[3-[[1-(3-tert-butylphenyl)-4-hydroxyiminocyclohexyl]amino]-1-(3,5-difluorophenyl)-2-hydroxypropyl]amino]-4-methoxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 143171428 |
| Molecular Formula | C30H35F2N3O5 |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.25 |
| IUPAC Name | 3-[[3-[[1-(3-tert-butylphenyl)-4-hydroxyiminocyclohexyl]amino]-1-(3,5-difluorophenyl)-2-hydroxypropyl]amino]-4-methoxycyclobut-3-ene-1,2-dione |
| SMILES | COc1c(NC(c2cc(F)cc(F)c2)C(O)CNC2(c3cccc(C(C)(C)C)c3)CCC(=NO)CC2)c(=O)c1=O |
| InChI | InChI=1S/C30H35F2N3O5/c1-29(2,3)18-6-5-7-19(14-18)30(10-8-22(35-39)9-11-30)33-16-23(36)24(17-12-20(31)15-21(32)13-17)34-25-26(37)27(38)28(25)40-4/h5-7,12-15,23-24,33-34,36,39H,8-11,16H2,1-4H3/b35-22- |
| InChIKey | NEZUJOUZAJSHAC-QHDYCIAZSA-N |
| XLogP | 4.27 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|