About ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate
ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate (PubChem CID 143171444) has the molecular formula C15H30O2S
and a molecular weight of 274.47 g/mol. Its IUPAC name is ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate.
Molecular Properties
| Compound Name | ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate |
| PubChem CID | 143171444 |
| Molecular Formula | C15H30O2S |
| Molecular Weight | 274.47 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate |
| SMILES | C=C1CCCC(C(=O)OCCS(C)(C)C)C1.CC |
| InChI | InChI=1S/C13H24O2S.C2H6/c1-11-6-5-7-12(10-11)13(14)15-8-9-16(2,3)4;1-2/h12H,1,5-10H2,2-4H3;1-2H3 |
| InChIKey | CWBZVCQZSXAREB-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate?
The IUPAC name of ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate (CID 143171444) is ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate.
What is the SMILES notation for ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate?
The canonical SMILES for ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate is C=C1CCCC(C(=O)OCCS(C)(C)C)C1.CC.
What is the InChIKey of ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate?
The InChIKey is CWBZVCQZSXAREB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O2S.C2H6/c1-11-6-5-7-12(10-11)13(14)15-8-9-16(2,3)4;1-2/h12H,1,5-10H2,2-4H3;1-2H3.
What are the key properties of ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate?
ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate has a molecular weight of 274.47 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(trimethyl-λ4-sulfanyl)ethyl 3-methylidenecyclohexane-1-carboxylate is sourced from PubChem (CID 143171444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).