About 2-bromo-4-iodo-1,3,5-trimethylbenzene
2-bromo-4-iodo-1,3,5-trimethylbenzene (PubChem CID 14317172) has the molecular formula C9H10BrI
and a molecular weight of 324.99 g/mol. Its IUPAC name is 2-bromo-4-iodo-1,3,5-trimethylbenzene.
Molecular Properties
| Compound Name | 2-bromo-4-iodo-1,3,5-trimethylbenzene |
| PubChem CID | 14317172 |
| Molecular Formula | C9H10BrI |
| Molecular Weight | 324.99 g/mol |
| Exact Mass | 323.90 |
| IUPAC Name | 2-bromo-4-iodo-1,3,5-trimethylbenzene |
| SMILES | Cc1cc(C)c(I)c(C)c1Br |
| InChI | InChI=1S/C9H10BrI/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,1-3H3 |
| InChIKey | GXQGWCHUWIPVCZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.99 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-iodo-1,3,5-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-iodo-1,3,5-trimethylbenzene?
The IUPAC name of 2-bromo-4-iodo-1,3,5-trimethylbenzene (CID 14317172) is 2-bromo-4-iodo-1,3,5-trimethylbenzene.
What is the SMILES notation for 2-bromo-4-iodo-1,3,5-trimethylbenzene?
The canonical SMILES for 2-bromo-4-iodo-1,3,5-trimethylbenzene is Cc1cc(C)c(I)c(C)c1Br.
What is the InChIKey of 2-bromo-4-iodo-1,3,5-trimethylbenzene?
The InChIKey is GXQGWCHUWIPVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrI/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,1-3H3.
What are the key properties of 2-bromo-4-iodo-1,3,5-trimethylbenzene?
2-bromo-4-iodo-1,3,5-trimethylbenzene has a molecular weight of 324.99 g/mol, XLogP of 3.98, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-iodo-1,3,5-trimethylbenzene is sourced from PubChem (CID 14317172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).