C35H65N5O — CID 143172565
4-[[[(Z)-3-(2,5-dimethylcyclohexa-1,3-dien-1-yl)pent-3-enyl]-ethylamino]methyl]-N'-[(E)-2-methyl-3-methylidenenon-1-enyl]piperidine-1-carboximidamide;ethane;hydroxylamine (PubChem CID 143172565) has the molecular formula C35H65N5O and a molecular weight of 571.94 g/mol. Its IUPAC name is 4-[[[(Z)-3-(2,5-dimethylcyclohexa-1,3-dien-1-yl)pent-3-enyl]-ethylamino]methyl]-N'-[(E)-2-methyl-3-methylidenenon-1-enyl]piperidine-1-carboximidamide;ethane;hydroxylamine.
| Compound Name | 4-[[[(Z)-3-(2,5-dimethylcyclohexa-1,3-dien-1-yl)pent-3-enyl]-ethylamino]methyl]-N'-[(E)-2-methyl-3-methylidenenon-1-enyl]piperidine-1-carboximidamide;ethane;hydroxylamine |
|---|---|
| PubChem CID | 143172565 |
| Molecular Formula | C35H65N5O |
| Molecular Weight | 571.94 g/mol |
| Exact Mass | 571.52 |
| IUPAC Name | 4-[[[(Z)-3-(2,5-dimethylcyclohexa-1,3-dien-1-yl)pent-3-enyl]-ethylamino]methyl]-N'-[(E)-2-methyl-3-methylidenenon-1-enyl]piperidine-1-carboximidamide;ethane;hydroxylamine |
| SMILES | C=C(CCCCCC)/C(C)=C/N=C(\N)N1CCC(CN(CC)CC/C(=C/C)C2=C(C)C=CC(C)C2)CC1.CC.NO |
| InChI | InChI=1S/C33H56N4.C2H6.H3NO/c1-8-11-12-13-14-27(5)29(7)24-35-33(34)37-21-17-30(18-22-37)25-36(10-3)20-19-31(9-2)32-23-26(4)15-16-28(32)6;2*1-2/h9,15-16,24,26,30H,5,8,10-14,17-23,25H2,1-4,6-7H3,(H2,34,35);1-2H3;2H,1H2/b29-24+,31-9-;; |
| InChIKey | ASGUGOZJUDGIAJ-QFPOXORISA-N |
| XLogP | 8.37 |
| TPSA | 91.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.94 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|