C26H25FO4S — CID 143173212
(2S,3R,4S,5S,6S)-2-[3-[(5-fluoro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)-5-methyloxane-3,4-diol (PubChem CID 143173212) has the molecular formula C26H25FO4S and a molecular weight of 452.55 g/mol. Its IUPAC name is (2S,3R,4S,5S,6S)-2-[3-[(5-fluoro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)-5-methyloxane-3,4-diol.
| Compound Name | (2S,3R,4S,5S,6S)-2-[3-[(5-fluoro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)-5-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 143173212 |
| Molecular Formula | C26H25FO4S |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.15 |
| IUPAC Name | (2S,3R,4S,5S,6S)-2-[3-[(5-fluoro-1-benzothiophen-2-yl)methyl]naphthalen-1-yl]-6-(hydroxymethyl)-5-methyloxane-3,4-diol |
| SMILES | C[C@H]1[C@H](O)[C@@H](O)[C@H](c2cc(Cc3cc4cc(F)ccc4s3)cc3ccccc23)O[C@@H]1CO |
| InChI | InChI=1S/C26H25FO4S/c1-14-22(13-28)31-26(25(30)24(14)29)21-10-15(8-16-4-2-3-5-20(16)21)9-19-12-17-11-18(27)6-7-23(17)32-19/h2-8,10-12,14,22,24-26,28-30H,9,13H2,1H3/t14-,22-,24+,25-,26+/m1/s1 |
| InChIKey | KANBXBQGRDAKGY-REONXXALSA-N |
| XLogP | 4.57 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |