C10H19NO — CID 143173311
2-[(1E,3E)-hexa-1,3-dienoxy]-N,N-dimethylethanamine (PubChem CID 143173311) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 2-[(1E,3E)-hexa-1,3-dienoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[(1E,3E)-hexa-1,3-dienoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 143173311 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 2-[(1E,3E)-hexa-1,3-dienoxy]-N,N-dimethylethanamine |
| SMILES | CC/C=C/C=C/OCCN(C)C |
| InChI | InChI=1S/C10H19NO/c1-4-5-6-7-9-12-10-8-11(2)3/h5-7,9H,4,8,10H2,1-3H3/b6-5+,9-7+ |
| InChIKey | CMMZKSUMPCTDKT-SBIWHPGTSA-N |
| XLogP | 2.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|