C25H24N2O7S2 — CID 143173387
2-ethylthiophene;7-formamido-3-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 143173387) has the molecular formula C25H24N2O7S2 and a molecular weight of 528.61 g/mol. Its IUPAC name is 2-ethylthiophene;7-formamido-3-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | 2-ethylthiophene;7-formamido-3-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 143173387 |
| Molecular Formula | C25H24N2O7S2 |
| Molecular Weight | 528.61 g/mol |
| Exact Mass | 528.10 |
| IUPAC Name | 2-ethylthiophene;7-formamido-3-[(4-methyl-2-oxochromen-7-yl)oxymethyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CCc1cccs1.Cc1cc(=O)oc2cc(OCC3=C(C(=O)O)N4C(=O)C(NC=O)C4SC3)ccc12 |
| InChI | InChI=1S/C19H16N2O7S.C6H8S/c1-9-4-14(23)28-13-5-11(2-3-12(9)13)27-6-10-7-29-18-15(20-8-22)17(24)21(18)16(10)19(25)26;1-2-6-4-3-5-7-6/h2-5,8,15,18H,6-7H2,1H3,(H,20,22)(H,25,26);3-5H,2H2,1H3 |
| InChIKey | HGRCAZFHKFBARL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 126.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|