About (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine
(4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine (PubChem CID 143173582) has the molecular formula C12H20FN
and a molecular weight of 197.30 g/mol. Its IUPAC name is (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine.
Molecular Properties
| Compound Name | (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine |
| PubChem CID | 143173582 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine |
| SMILES | C=C/C=C(/F)C(CCN(C)C)=C(C)C |
| InChI | InChI=1S/C12H20FN/c1-6-7-12(13)11(10(2)3)8-9-14(4)5/h6-7H,1,8-9H2,2-5H3/b12-7+ |
| InChIKey | RDDXLUPKJOCCRD-KPKJPENVSA-N |
| XLogP | 3.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine?
The IUPAC name of (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine (CID 143173582) is (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine.
What is the SMILES notation for (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine?
The canonical SMILES for (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine is C=C/C=C(/F)C(CCN(C)C)=C(C)C.
What is the InChIKey of (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine?
The InChIKey is RDDXLUPKJOCCRD-KPKJPENVSA-N. The full InChI is InChI=1S/C12H20FN/c1-6-7-12(13)11(10(2)3)8-9-14(4)5/h6-7H,1,8-9H2,2-5H3/b12-7+.
What are the key properties of (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine?
(4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine has a molecular weight of 197.30 g/mol, XLogP of 3.31, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-fluoro-N,N-dimethyl-3-propan-2-ylidenehepta-4,6-dien-1-amine is sourced from PubChem (CID 143173582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).