C14H21N — CID 143173694
2-ethyl-5-propyl-3,4-dihydro-1H-isoquinoline (PubChem CID 143173694) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 2-ethyl-5-propyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-ethyl-5-propyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 143173694 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 2-ethyl-5-propyl-3,4-dihydro-1H-isoquinoline |
| SMILES | CCCc1cccc2c1CCN(CC)C2 |
| InChI | InChI=1S/C14H21N/c1-3-6-12-7-5-8-13-11-15(4-2)10-9-14(12)13/h5,7-8H,3-4,6,9-11H2,1-2H3 |
| InChIKey | OFZWSFUNLYFVEA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |