About cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate
cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate (PubChem CID 143174119) has the molecular formula C22H33N3O4
and a molecular weight of 403.52 g/mol. Its IUPAC name is cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate.
Molecular Properties
| Compound Name | cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate |
| PubChem CID | 143174119 |
| Molecular Formula | C22H33N3O4 |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.25 |
| IUPAC Name | cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(c2ccc(C3(C(N)=O)CC3)cc2)CC1.OC1CCCCC1 |
| InChI | InChI=1S/C16H21N3O3.C6H12O/c1-22-15(21)19-10-8-18(9-11-19)13-4-2-12(3-5-13)16(6-7-16)14(17)20;7-6-4-2-1-3-5-6/h2-5H,6-11H2,1H3,(H2,17,20);6-7H,1-5H2 |
| InChIKey | CHPFAYZTUDALFJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 96.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate?
The IUPAC name of cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate (CID 143174119) is cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate.
What is the SMILES notation for cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate?
The canonical SMILES for cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate is COC(=O)N1CCN(c2ccc(C3(C(N)=O)CC3)cc2)CC1.OC1CCCCC1.
What is the InChIKey of cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate?
The InChIKey is CHPFAYZTUDALFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O3.C6H12O/c1-22-15(21)19-10-8-18(9-11-19)13-4-2-12(3-5-13)16(6-7-16)14(17)20;7-6-4-2-1-3-5-6/h2-5H,6-11H2,1H3,(H2,17,20);6-7H,1-5H2.
What are the key properties of cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate?
cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate has a molecular weight of 403.52 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexanol;methyl 4-[4-(1-carbamoylcyclopropyl)phenyl]piperazine-1-carboxylate is sourced from PubChem (CID 143174119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).