C14H23NO2S — CID 143174237
1-[(2Z,4E,6Z)-6-methylocta-2,4,6-trien-4-yl]sulfonylpiperidine (PubChem CID 143174237) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 1-[(2Z,4E,6Z)-6-methylocta-2,4,6-trien-4-yl]sulfonylpiperidine.
| Compound Name | 1-[(2Z,4E,6Z)-6-methylocta-2,4,6-trien-4-yl]sulfonylpiperidine |
|---|---|
| PubChem CID | 143174237 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-[(2Z,4E,6Z)-6-methylocta-2,4,6-trien-4-yl]sulfonylpiperidine |
| SMILES | C/C=C\C(=C/C(C)=C\C)S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C14H23NO2S/c1-4-9-14(12-13(3)5-2)18(16,17)15-10-7-6-8-11-15/h4-5,9,12H,6-8,10-11H2,1-3H3/b9-4-,13-5-,14-12+ |
| InChIKey | QDRIBFWCOCQULE-MRSSKMKVSA-N |
| XLogP | 3.23 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|