C32H34N2O3 — CID 143174345
(9-ethyl-6-methoxycarbazol-3-yl)methanol;(9-ethyl-6-methylcarbazol-3-yl)methanol (PubChem CID 143174345) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is (9-ethyl-6-methoxycarbazol-3-yl)methanol;(9-ethyl-6-methylcarbazol-3-yl)methanol.
| Compound Name | (9-ethyl-6-methoxycarbazol-3-yl)methanol;(9-ethyl-6-methylcarbazol-3-yl)methanol |
|---|---|
| PubChem CID | 143174345 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | (9-ethyl-6-methoxycarbazol-3-yl)methanol;(9-ethyl-6-methylcarbazol-3-yl)methanol |
| SMILES | CCn1c2ccc(C)cc2c2cc(CO)ccc21.CCn1c2ccc(CO)cc2c2cc(OC)ccc21 |
| InChI | InChI=1S/C16H17NO2.C16H17NO/c1-3-17-15-6-4-11(10-18)8-13(15)14-9-12(19-2)5-7-16(14)17;1-3-17-15-6-4-11(2)8-13(15)14-9-12(10-18)5-7-16(14)17/h4-9,18H,3,10H2,1-2H3;4-9,18H,3,10H2,1-2H3 |
| InChIKey | IRPUPFRQHSIJHG-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 59.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |