C26H29F4N3O2 — CID 143174797
3-[[(3S)-1-ethylpiperidin-3-yl]methyl]-2-(2-methylphenyl)-6-(2,2,3,3-tetrafluoropropoxy)quinazolin-4-one (PubChem CID 143174797) has the molecular formula C26H29F4N3O2 and a molecular weight of 491.53 g/mol. Its IUPAC name is 3-[[(3S)-1-ethylpiperidin-3-yl]methyl]-2-(2-methylphenyl)-6-(2,2,3,3-tetrafluoropropoxy)quinazolin-4-one.
| Compound Name | 3-[[(3S)-1-ethylpiperidin-3-yl]methyl]-2-(2-methylphenyl)-6-(2,2,3,3-tetrafluoropropoxy)quinazolin-4-one |
|---|---|
| PubChem CID | 143174797 |
| Molecular Formula | C26H29F4N3O2 |
| Molecular Weight | 491.53 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 3-[[(3S)-1-ethylpiperidin-3-yl]methyl]-2-(2-methylphenyl)-6-(2,2,3,3-tetrafluoropropoxy)quinazolin-4-one |
| SMILES | CCN1CCC[C@H](Cn2c(-c3ccccc3C)nc3ccc(OCC(F)(F)C(F)F)cc3c2=O)C1 |
| InChI | InChI=1S/C26H29F4N3O2/c1-3-32-12-6-8-18(14-32)15-33-23(20-9-5-4-7-17(20)2)31-22-11-10-19(13-21(22)24(33)34)35-16-26(29,30)25(27)28/h4-5,7,9-11,13,18,25H,3,6,8,12,14-16H2,1-2H3/t18-/m0/s1 |
| InChIKey | UIWFIXBTCCLHAG-SFHVURJKSA-N |
| XLogP | 5.38 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.53 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|