C22H18ClN3O3 — CID 143175130
6-(4-chlorophenyl)-2-[6-(2-hydroxyethoxy)-3-pyridinyl]-3-methylquinazolin-4-one (PubChem CID 143175130) has the molecular formula C22H18ClN3O3 and a molecular weight of 407.86 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-2-[6-(2-hydroxyethoxy)-3-pyridinyl]-3-methylquinazolin-4-one.
| Compound Name | 6-(4-chlorophenyl)-2-[6-(2-hydroxyethoxy)-3-pyridinyl]-3-methylquinazolin-4-one |
|---|---|
| PubChem CID | 143175130 |
| Molecular Formula | C22H18ClN3O3 |
| Molecular Weight | 407.86 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | 6-(4-chlorophenyl)-2-[6-(2-hydroxyethoxy)-3-pyridinyl]-3-methylquinazolin-4-one |
| SMILES | Cn1c(-c2ccc(OCCO)nc2)nc2ccc(-c3ccc(Cl)cc3)cc2c1=O |
| InChI | InChI=1S/C22H18ClN3O3/c1-26-21(16-5-9-20(24-13-16)29-11-10-27)25-19-8-4-15(12-18(19)22(26)28)14-2-6-17(23)7-3-14/h2-9,12-13,27H,10-11H2,1H3 |
| InChIKey | QKSBHZZQEINLIO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.86 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |