About 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one
1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one (PubChem CID 143175154) has the molecular formula C26H25F2NO2
and a molecular weight of 421.49 g/mol. Its IUPAC name is 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one.
Molecular Properties
| Compound Name | 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one |
| PubChem CID | 143175154 |
| Molecular Formula | C26H25F2NO2 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one |
| SMILES | CCCCC(=O)c1cc(-c2ccc(F)c(F)c2)ccc1/N=C(\C)c1ccccc1OC |
| InChI | InChI=1S/C26H25F2NO2/c1-4-5-9-25(30)21-15-18(19-11-13-22(27)23(28)16-19)12-14-24(21)29-17(2)20-8-6-7-10-26(20)31-3/h6-8,10-16H,4-5,9H2,1-3H3/b29-17+ |
| InChIKey | QJJDVGYMZZGOSR-STBIYBPSSA-N |
| XLogP | 7.15 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one?
The IUPAC name of 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one (CID 143175154) is 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one.
What is the SMILES notation for 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one?
The canonical SMILES for 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one is CCCCC(=O)c1cc(-c2ccc(F)c(F)c2)ccc1/N=C(\C)c1ccccc1OC.
What is the InChIKey of 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one?
The InChIKey is QJJDVGYMZZGOSR-STBIYBPSSA-N. The full InChI is InChI=1S/C26H25F2NO2/c1-4-5-9-25(30)21-15-18(19-11-13-22(27)23(28)16-19)12-14-24(21)29-17(2)20-8-6-7-10-26(20)31-3/h6-8,10-16H,4-5,9H2,1-3H3/b29-17+.
What are the key properties of 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one?
1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one has a molecular weight of 421.49 g/mol, XLogP of 7.15, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(3,4-difluorophenyl)-2-[1-(2-methoxyphenyl)ethylideneamino]phenyl]pentan-1-one is sourced from PubChem (CID 143175154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).