C17H28N2O3 — CID 143176103
1-[4-[(3Z,5Z)-5,6-dimethoxy-2-methylidenehepta-3,5-dienyl]piperazin-1-yl]propan-1-one (PubChem CID 143176103) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-[4-[(3Z,5Z)-5,6-dimethoxy-2-methylidenehepta-3,5-dienyl]piperazin-1-yl]propan-1-one.
| Compound Name | 1-[4-[(3Z,5Z)-5,6-dimethoxy-2-methylidenehepta-3,5-dienyl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 143176103 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-[4-[(3Z,5Z)-5,6-dimethoxy-2-methylidenehepta-3,5-dienyl]piperazin-1-yl]propan-1-one |
| SMILES | C=C(/C=C\C(OC)=C(/C)OC)CN1CCN(C(=O)CC)CC1 |
| InChI | InChI=1S/C17H28N2O3/c1-6-17(20)19-11-9-18(10-12-19)13-14(2)7-8-16(22-5)15(3)21-4/h7-8H,2,6,9-13H2,1,3-5H3/b8-7-,16-15- |
| InChIKey | FGUOXLSXBXAMIP-DRGLTMLKSA-N |
| XLogP | 2.18 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|