C12H23N3O — CID 143176493
N-(2,3-dihydrofuran-2-ylmethyl)-N'-(1-methylpiperidin-4-yl)methanediamine (PubChem CID 143176493) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-(2,3-dihydrofuran-2-ylmethyl)-N'-(1-methylpiperidin-4-yl)methanediamine.
| Compound Name | N-(2,3-dihydrofuran-2-ylmethyl)-N'-(1-methylpiperidin-4-yl)methanediamine |
|---|---|
| PubChem CID | 143176493 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-(2,3-dihydrofuran-2-ylmethyl)-N'-(1-methylpiperidin-4-yl)methanediamine |
| SMILES | CN1CCC(NCNCC2CC=CO2)CC1 |
| InChI | InChI=1S/C12H23N3O/c1-15-6-4-11(5-7-15)14-10-13-9-12-3-2-8-16-12/h2,8,11-14H,3-7,9-10H2,1H3 |
| InChIKey | KRPWOHNXXFUMHQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|