C17H31N3O — CID 143176502
N-(cyclohepta-1,3,6-trien-1-ylmethyl)formamide;1-N,4-N-dimethylhexane-1,4-diamine (PubChem CID 143176502) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is N-(cyclohepta-1,3,6-trien-1-ylmethyl)formamide;1-N,4-N-dimethylhexane-1,4-diamine.
| Compound Name | N-(cyclohepta-1,3,6-trien-1-ylmethyl)formamide;1-N,4-N-dimethylhexane-1,4-diamine |
|---|---|
| PubChem CID | 143176502 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | N-(cyclohepta-1,3,6-trien-1-ylmethyl)formamide;1-N,4-N-dimethylhexane-1,4-diamine |
| SMILES | CCC(CCCNC)NC.O=CNCC1=CC=CCC=C1 |
| InChI | InChI=1S/C9H11NO.C8H20N2/c11-8-10-7-9-5-3-1-2-4-6-9;1-4-8(10-3)6-5-7-9-2/h1,3-6,8H,2,7H2,(H,10,11);8-10H,4-7H2,1-3H3 |
| InChIKey | ODKGFIDHZWQJNF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|