About 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea
1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea (PubChem CID 143176535) has the molecular formula C16H26FN3O
and a molecular weight of 295.40 g/mol. Its IUPAC name is 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea.
Molecular Properties
| Compound Name | 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea |
| PubChem CID | 143176535 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea |
| SMILES | C=C(F)/C=C(\C=C/CC)CNC(=O)NC1CCN(C)CC1 |
| InChI | InChI=1S/C16H26FN3O/c1-4-5-6-14(11-13(2)17)12-18-16(21)19-15-7-9-20(3)10-8-15/h5-6,11,15H,2,4,7-10,12H2,1,3H3,(H2,18,19,21)/b6-5-,14-11+ |
| InChIKey | SZMYFLNWKDJDPD-OQSGZJJPSA-N |
| XLogP | 2.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea?
The IUPAC name of 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea (CID 143176535) is 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea.
What is the SMILES notation for 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea?
The canonical SMILES for 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea is C=C(F)/C=C(\C=C/CC)CNC(=O)NC1CCN(C)CC1.
What is the InChIKey of 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea?
The InChIKey is SZMYFLNWKDJDPD-OQSGZJJPSA-N. The full InChI is InChI=1S/C16H26FN3O/c1-4-5-6-14(11-13(2)17)12-18-16(21)19-15-7-9-20(3)10-8-15/h5-6,11,15H,2,4,7-10,12H2,1,3H3,(H2,18,19,21)/b6-5-,14-11+.
What are the key properties of 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea?
1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea has a molecular weight of 295.40 g/mol, XLogP of 2.76, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z,2E)-2-(2-fluoroprop-2-enylidene)hex-3-enyl]-3-(1-methylpiperidin-4-yl)urea is sourced from PubChem (CID 143176535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).