C17H28FN3O — CID 143176584
1-[(2E,3Z,5E)-2-ethylidene-5-fluoroocta-3,5-dienyl]-3-(1-methylpiperidin-4-yl)urea (PubChem CID 143176584) has the molecular formula C17H28FN3O and a molecular weight of 309.43 g/mol. Its IUPAC name is 1-[(2E,3Z,5E)-2-ethylidene-5-fluoroocta-3,5-dienyl]-3-(1-methylpiperidin-4-yl)urea.
| Compound Name | 1-[(2E,3Z,5E)-2-ethylidene-5-fluoroocta-3,5-dienyl]-3-(1-methylpiperidin-4-yl)urea |
|---|---|
| PubChem CID | 143176584 |
| Molecular Formula | C17H28FN3O |
| Molecular Weight | 309.43 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | 1-[(2E,3Z,5E)-2-ethylidene-5-fluoroocta-3,5-dienyl]-3-(1-methylpiperidin-4-yl)urea |
| SMILES | C/C=C(\C=C/C(F)=C\CC)CNC(=O)NC1CCN(C)CC1 |
| InChI | InChI=1S/C17H28FN3O/c1-4-6-15(18)8-7-14(5-2)13-19-17(22)20-16-9-11-21(3)12-10-16/h5-8,16H,4,9-13H2,1-3H3,(H2,19,20,22)/b8-7-,14-5+,15-6+ |
| InChIKey | HYNFMFRRBZQDCB-ARVXKQOISA-N |
| XLogP | 3.15 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|