C28H38N2O3S — CID 143176799
N-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-methoxy-1-phenylsulfanylbutan-2-yl]-3-hydroxy-2-methylbenzamide (PubChem CID 143176799) has the molecular formula C28H38N2O3S and a molecular weight of 482.69 g/mol. Its IUPAC name is N-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-methoxy-1-phenylsulfanylbutan-2-yl]-3-hydroxy-2-methylbenzamide.
| Compound Name | N-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-methoxy-1-phenylsulfanylbutan-2-yl]-3-hydroxy-2-methylbenzamide |
|---|---|
| PubChem CID | 143176799 |
| Molecular Formula | C28H38N2O3S |
| Molecular Weight | 482.69 g/mol |
| Exact Mass | 482.26 |
| IUPAC Name | N-[4-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-yl)-3-methoxy-1-phenylsulfanylbutan-2-yl]-3-hydroxy-2-methylbenzamide |
| SMILES | COC(CN1CCC2CCCCC2C1)C(CSc1ccccc1)NC(=O)c1cccc(O)c1C |
| InChI | InChI=1S/C28H38N2O3S/c1-20-24(13-8-14-26(20)31)28(32)29-25(19-34-23-11-4-3-5-12-23)27(33-2)18-30-16-15-21-9-6-7-10-22(21)17-30/h3-5,8,11-14,21-22,25,27,31H,6-7,9-10,15-19H2,1-2H3,(H,29,32) |
| InChIKey | YQNBGXNTTWHSOE-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.69 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |