C19H23N3O3 — CID 1431769
[2-(3,4-dimethoxyanilino)-3-pyridinyl]-piperidin-1-ylmethanone (PubChem CID 1431769) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [2-(3,4-dimethoxyanilino)-3-pyridinyl]-piperidin-1-ylmethanone.
| Compound Name | [2-(3,4-dimethoxyanilino)-3-pyridinyl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 1431769 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [2-(3,4-dimethoxyanilino)-3-pyridinyl]-piperidin-1-ylmethanone |
| SMILES | COc1ccc(Nc2ncccc2C(=O)N2CCCCC2)cc1OC |
| InChI | InChI=1S/C19H23N3O3/c1-24-16-9-8-14(13-17(16)25-2)21-18-15(7-6-10-20-18)19(23)22-11-4-3-5-12-22/h6-10,13H,3-5,11-12H2,1-2H3,(H,20,21) |
| InChIKey | GKXGIEGAKRBRNF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |