About ethane;5-phenyl-1,2-thiazole
ethane;5-phenyl-1,2-thiazole (PubChem CID 143177315) has the molecular formula C11H13NS
and a molecular weight of 191.30 g/mol. Its IUPAC name is ethane;5-phenyl-1,2-thiazole.
Molecular Properties
| Compound Name | ethane;5-phenyl-1,2-thiazole |
| PubChem CID | 143177315 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | ethane;5-phenyl-1,2-thiazole |
| SMILES | CC.c1ccc(-c2ccns2)cc1 |
| InChI | InChI=1S/C9H7NS.C2H6/c1-2-4-8(5-3-1)9-6-7-10-11-9;1-2/h1-7H;1-2H3 |
| InChIKey | OZDREBNULONPRU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-phenyl-1,2-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-phenyl-1,2-thiazole?
The IUPAC name of ethane;5-phenyl-1,2-thiazole (CID 143177315) is ethane;5-phenyl-1,2-thiazole.
What is the SMILES notation for ethane;5-phenyl-1,2-thiazole?
The canonical SMILES for ethane;5-phenyl-1,2-thiazole is CC.c1ccc(-c2ccns2)cc1.
What is the InChIKey of ethane;5-phenyl-1,2-thiazole?
The InChIKey is OZDREBNULONPRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS.C2H6/c1-2-4-8(5-3-1)9-6-7-10-11-9;1-2/h1-7H;1-2H3.
What are the key properties of ethane;5-phenyl-1,2-thiazole?
ethane;5-phenyl-1,2-thiazole has a molecular weight of 191.30 g/mol, XLogP of 3.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-phenyl-1,2-thiazole is sourced from PubChem (CID 143177315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).