C14H12N2OS — CID 143177380
2-(5-aminocyclohepta-1,4,6-trien-1-yl)-1,3-benzothiazol-6-ol (PubChem CID 143177380) has the molecular formula C14H12N2OS and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(5-aminocyclohepta-1,4,6-trien-1-yl)-1,3-benzothiazol-6-ol.
| Compound Name | 2-(5-aminocyclohepta-1,4,6-trien-1-yl)-1,3-benzothiazol-6-ol |
|---|---|
| PubChem CID | 143177380 |
| Molecular Formula | C14H12N2OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | 2-(5-aminocyclohepta-1,4,6-trien-1-yl)-1,3-benzothiazol-6-ol |
| SMILES | NC1=CCC=C(c2nc3ccc(O)cc3s2)C=C1 |
| InChI | InChI=1S/C14H12N2OS/c15-10-3-1-2-9(4-5-10)14-16-12-7-6-11(17)8-13(12)18-14/h2-8,17H,1,15H2 |
| InChIKey | IJIQPWUBUBCDHY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |