C14H24N2O — CID 143177592
ethane;1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-4-methylimidazolidin-2-one (PubChem CID 143177592) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is ethane;1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-4-methylimidazolidin-2-one.
| Compound Name | ethane;1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-4-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 143177592 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | ethane;1-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]-4-methylimidazolidin-2-one |
| SMILES | C=C/C=C\C(=C/C)CN1CC(C)NC1=O.CC |
| InChI | InChI=1S/C12H18N2O.C2H6/c1-4-6-7-11(5-2)9-14-8-10(3)13-12(14)15;1-2/h4-7,10H,1,8-9H2,2-3H3,(H,13,15);1-2H3/b7-6-,11-5+; |
| InChIKey | DPXWKHXZXKMYCF-RSKDWUOFSA-N |
| XLogP | 3.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|