C25H25ClF3N7 — CID 143177698
N-[(2E,4Z)-1-chlorohepta-2,4,6-trien-3-yl]-N-methyl-2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinazolin-4-amine (PubChem CID 143177698) has the molecular formula C25H25ClF3N7 and a molecular weight of 515.97 g/mol. Its IUPAC name is N-[(2E,4Z)-1-chlorohepta-2,4,6-trien-3-yl]-N-methyl-2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinazolin-4-amine.
| Compound Name | N-[(2E,4Z)-1-chlorohepta-2,4,6-trien-3-yl]-N-methyl-2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 143177698 |
| Molecular Formula | C25H25ClF3N7 |
| Molecular Weight | 515.97 g/mol |
| Exact Mass | 515.18 |
| IUPAC Name | N-[(2E,4Z)-1-chlorohepta-2,4,6-trien-3-yl]-N-methyl-2-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]quinazolin-4-amine |
| SMILES | C=C/C=C\C(=C/CCl)N(C)c1nc(N2CCN(c3nccc(C(F)(F)F)n3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C25H25ClF3N7/c1-3-4-7-18(10-12-26)34(2)22-19-8-5-6-9-20(19)31-24(33-22)36-16-14-35(15-17-36)23-30-13-11-21(32-23)25(27,28)29/h3-11,13H,1,12,14-17H2,2H3/b7-4-,18-10+ |
| InChIKey | VEZXYVJBDZZAEM-WTWSDYARSA-N |
| XLogP | 5.07 |
| TPSA | 61.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.97 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|