C33H32ClF2N5 — CID 143177792
2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-N-[(2E,4Z)-1-chlorohepta-2,4,6-trien-3-yl]-N-methylquinazolin-4-amine (PubChem CID 143177792) has the molecular formula C33H32ClF2N5 and a molecular weight of 572.10 g/mol. Its IUPAC name is 2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-N-[(2E,4Z)-1-chlorohepta-2,4,6-trien-3-yl]-N-methylquinazolin-4-amine.
| Compound Name | 2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-N-[(2E,4Z)-1-chlorohepta-2,4,6-trien-3-yl]-N-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 143177792 |
| Molecular Formula | C33H32ClF2N5 |
| Molecular Weight | 572.10 g/mol |
| Exact Mass | 571.23 |
| IUPAC Name | 2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-N-[(2E,4Z)-1-chlorohepta-2,4,6-trien-3-yl]-N-methylquinazolin-4-amine |
| SMILES | C=C/C=C\C(=C/CCl)N(C)c1nc(N2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)nc2ccccc12 |
| InChI | InChI=1S/C33H32ClF2N5/c1-3-4-7-28(18-19-34)39(2)32-29-8-5-6-9-30(29)37-33(38-32)41-22-20-40(21-23-41)31(24-10-14-26(35)15-11-24)25-12-16-27(36)17-13-25/h3-18,31H,1,19-23H2,2H3/b7-4-,28-18+ |
| InChIKey | LHIIQPHQNLBSFV-FRPTXOONSA-N |
| XLogP | 7.12 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.10 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|