About N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide
N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide (PubChem CID 143179166) has the molecular formula C10H13NS
and a molecular weight of 179.29 g/mol. Its IUPAC name is N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide.
Molecular Properties
| Compound Name | N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide |
| PubChem CID | 143179166 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide |
| SMILES | C/C=C/NC(=S)C1=CCCC=C1 |
| InChI | InChI=1S/C10H13NS/c1-2-8-11-10(12)9-6-4-3-5-7-9/h2,4,6-8H,3,5H2,1H3,(H,11,12)/b8-2+ |
| InChIKey | UYHGPYACZQEWIV-KRXBUXKQSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide?
The IUPAC name of N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide (CID 143179166) is N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide.
What is the SMILES notation for N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide?
The canonical SMILES for N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide is C/C=C/NC(=S)C1=CCCC=C1.
What is the InChIKey of N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide?
The InChIKey is UYHGPYACZQEWIV-KRXBUXKQSA-N. The full InChI is InChI=1S/C10H13NS/c1-2-8-11-10(12)9-6-4-3-5-7-9/h2,4,6-8H,3,5H2,1H3,(H,11,12)/b8-2+.
What are the key properties of N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide?
N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide has a molecular weight of 179.29 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide is sourced from PubChem (CID 143179166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).