C10H13NS — CID 143179166
N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide (PubChem CID 143179166) has the molecular formula C10H13NS and a molecular weight of 179.29 g/mol. Its IUPAC name is N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide.
| Compound Name | N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide |
|---|---|
| PubChem CID | 143179166 |
| Molecular Formula | C10H13NS |
| Molecular Weight | 179.29 g/mol |
| Exact Mass | 179.08 |
| IUPAC Name | N-[(E)-prop-1-enyl]cyclohexa-1,5-diene-1-carbothioamide |
| SMILES | C/C=C/NC(=S)C1=CCCC=C1 |
| InChI | InChI=1S/C10H13NS/c1-2-8-11-10(12)9-6-4-3-5-7-9/h2,4,6-8H,3,5H2,1H3,(H,11,12)/b8-2+ |
| InChIKey | UYHGPYACZQEWIV-KRXBUXKQSA-N |
| XLogP | 2.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|