C11H18N2O — CID 143179325
2-[[(2E,5Z)-6-methylocta-2,5,7-trien-2-yl]amino]acetamide (PubChem CID 143179325) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is 2-[[(2E,5Z)-6-methylocta-2,5,7-trien-2-yl]amino]acetamide.
| Compound Name | 2-[[(2E,5Z)-6-methylocta-2,5,7-trien-2-yl]amino]acetamide |
|---|---|
| PubChem CID | 143179325 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | 2-[[(2E,5Z)-6-methylocta-2,5,7-trien-2-yl]amino]acetamide |
| SMILES | C=C/C(C)=C\C/C=C(\C)NCC(N)=O |
| InChI | InChI=1S/C11H18N2O/c1-4-9(2)6-5-7-10(3)13-8-11(12)14/h4,6-7,13H,1,5,8H2,2-3H3,(H2,12,14)/b9-6-,10-7+ |
| InChIKey | WBLABIRGVDHGDH-PCCLLEMOSA-N |
| XLogP | 1.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|