C9H12N4 — CID 143179512
1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methyltetrazole (PubChem CID 143179512) has the molecular formula C9H12N4 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methyltetrazole.
| Compound Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methyltetrazole |
|---|---|
| PubChem CID | 143179512 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 1-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-5-methyltetrazole |
| SMILES | C=C/C=C(\C=C/C)n1nnnc1C |
| InChI | InChI=1S/C9H12N4/c1-4-6-9(7-5-2)13-8(3)10-11-12-13/h4-7H,1H2,2-3H3/b7-5-,9-6+ |
| InChIKey | ZDCFRDNOLUGOHE-XCZNYUDNSA-N |
| XLogP | 1.58 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|