C18H14F2 — CID 143179618
(1E,3Z)-1-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-4-methylcycloocta-1,3-dien-6-yne (PubChem CID 143179618) has the molecular formula C18H14F2 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1E,3Z)-1-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-4-methylcycloocta-1,3-dien-6-yne.
| Compound Name | (1E,3Z)-1-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-4-methylcycloocta-1,3-dien-6-yne |
|---|---|
| PubChem CID | 143179618 |
| Molecular Formula | C18H14F2 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | (1E,3Z)-1-[2-(2,6-difluoro-4-methylphenyl)ethynyl]-4-methylcycloocta-1,3-dien-6-yne |
| SMILES | C/C1=C/C=C(/C#Cc2c(F)cc(C)cc2F)CC#CC1 |
| InChI | InChI=1S/C18H14F2/c1-13-5-3-4-6-15(8-7-13)9-10-16-17(19)11-14(2)12-18(16)20/h7-8,11-12H,5-6H2,1-2H3/b13-7-,15-8+ |
| InChIKey | PNDUEGKDUYSAMP-VXBLSONLSA-N |
| XLogP | 4.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|