C13H22N+ — CID 14318011
2,3,4,5,6-pentamethyl-1-propan-2-ylpyridin-1-ium (PubChem CID 14318011) has the molecular formula C13H22N+ and a molecular weight of 192.33 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-1-propan-2-ylpyridin-1-ium.
| Compound Name | 2,3,4,5,6-pentamethyl-1-propan-2-ylpyridin-1-ium |
|---|---|
| PubChem CID | 14318011 |
| Molecular Formula | C13H22N+ |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.17 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-1-propan-2-ylpyridin-1-ium |
| SMILES | Cc1c(C)c(C)[n+](C(C)C)c(C)c1C |
| InChI | InChI=1S/C13H22N/c1-8(2)14-12(6)10(4)9(3)11(5)13(14)7/h8H,1-7H3/q+1 |
| InChIKey | WKBMPQZFZCDBNN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|